C36H41N3O4 — CID 72944264
N'-[[1-[1-(2,2-dimethylpropanoyloxy)-2-methylpropyl]pyridin-1-ium-3-yl]methyl]-N-[4-[2-(2-phenylphenyl)ethoxy]phenyl]carbamimidate (PubChem CID 72944264) has the molecular formula C36H41N3O4 and a molecular weight of 579.74 g/mol. Its IUPAC name is N'-[[1-[1-(2,2-dimethylpropanoyloxy)-2-methylpropyl]pyridin-1-ium-3-yl]methyl]-N-[4-[2-(2-phenylphenyl)ethoxy]phenyl]carbamimidate.
| Compound Name | N'-[[1-[1-(2,2-dimethylpropanoyloxy)-2-methylpropyl]pyridin-1-ium-3-yl]methyl]-N-[4-[2-(2-phenylphenyl)ethoxy]phenyl]carbamimidate |
|---|---|
| PubChem CID | 72944264 |
| Molecular Formula | C36H41N3O4 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | N'-[[1-[1-(2,2-dimethylpropanoyloxy)-2-methylpropyl]pyridin-1-ium-3-yl]methyl]-N-[4-[2-(2-phenylphenyl)ethoxy]phenyl]carbamimidate |
| SMILES | CC(C)C(OC(=O)C(C)(C)C)[n+]1cccc(C/N=C(\[O-])Nc2ccc(OCCc3ccccc3-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C36H41N3O4/c1-26(2)33(43-34(40)36(3,4)5)39-22-11-12-27(25-39)24-37-35(41)38-30-17-19-31(20-18-30)42-23-21-29-15-9-10-16-32(29)28-13-7-6-8-14-28/h6-20,22,25-26,33H,21,23-24H2,1-5H3,(H-,37,38,41) |
| InChIKey | KPVWLMVJNPFDJH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|