C30H29NO3 — CID 17130212
2-(4-phenylphenoxy)-N-[4-(3-phenylpropoxy)phenyl]propanamide (PubChem CID 17130212) has the molecular formula C30H29NO3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 2-(4-phenylphenoxy)-N-[4-(3-phenylpropoxy)phenyl]propanamide.
| Compound Name | 2-(4-phenylphenoxy)-N-[4-(3-phenylpropoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 17130212 |
| Molecular Formula | C30H29NO3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-(4-phenylphenoxy)-N-[4-(3-phenylpropoxy)phenyl]propanamide |
| SMILES | CC(Oc1ccc(-c2ccccc2)cc1)C(=O)Nc1ccc(OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H29NO3/c1-23(34-29-18-14-26(15-19-29)25-12-6-3-7-13-25)30(32)31-27-16-20-28(21-17-27)33-22-8-11-24-9-4-2-5-10-24/h2-7,9-10,12-21,23H,8,11,22H2,1H3,(H,31,32) |
| InChIKey | XYBCKUSSJPDCNM-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|