C24H24N2O3 — CID 43915059
N-[4-[2-(methylamino)-2-oxoethyl]phenyl]-2-(4-phenylphenoxy)propanamide (PubChem CID 43915059) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[4-[2-(methylamino)-2-oxoethyl]phenyl]-2-(4-phenylphenoxy)propanamide.
| Compound Name | N-[4-[2-(methylamino)-2-oxoethyl]phenyl]-2-(4-phenylphenoxy)propanamide |
|---|---|
| PubChem CID | 43915059 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[4-[2-(methylamino)-2-oxoethyl]phenyl]-2-(4-phenylphenoxy)propanamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)C(C)Oc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-17(24(28)26-21-12-8-18(9-13-21)16-23(27)25-2)29-22-14-10-20(11-15-22)19-6-4-3-5-7-19/h3-15,17H,16H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | AENZKQHAHXSUTM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |