C32H32N4O5 — CID 72943708
N'-[[1-(morpholine-4-carbonyloxymethyl)pyridin-1-ium-3-yl]methyl]-N-[4-[(2-phenylphenoxy)methyl]phenyl]carbamimidate (PubChem CID 72943708) has the molecular formula C32H32N4O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is N'-[[1-(morpholine-4-carbonyloxymethyl)pyridin-1-ium-3-yl]methyl]-N-[4-[(2-phenylphenoxy)methyl]phenyl]carbamimidate.
| Compound Name | N'-[[1-(morpholine-4-carbonyloxymethyl)pyridin-1-ium-3-yl]methyl]-N-[4-[(2-phenylphenoxy)methyl]phenyl]carbamimidate |
|---|---|
| PubChem CID | 72943708 |
| Molecular Formula | C32H32N4O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | N'-[[1-(morpholine-4-carbonyloxymethyl)pyridin-1-ium-3-yl]methyl]-N-[4-[(2-phenylphenoxy)methyl]phenyl]carbamimidate |
| SMILES | O=C(OC[n+]1cccc(C/N=C(\[O-])Nc2ccc(COc3ccccc3-c3ccccc3)cc2)c1)N1CCOCC1 |
| InChI | InChI=1S/C32H32N4O5/c37-31(33-21-26-7-6-16-35(22-26)24-41-32(38)36-17-19-39-20-18-36)34-28-14-12-25(13-15-28)23-40-30-11-5-4-10-29(30)27-8-2-1-3-9-27/h1-16,22H,17-21,23-24H2,(H-,33,34,37) |
| InChIKey | XYSJRTLUMKALQP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|