C13H22N2O2 — CID 143768573
ethane;N'-[(3E)-hexa-1,3,5-trien-3-yl]-N,N'-dimethylpropanediamide (PubChem CID 143768573) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is ethane;N'-[(3E)-hexa-1,3,5-trien-3-yl]-N,N'-dimethylpropanediamide.
| Compound Name | ethane;N'-[(3E)-hexa-1,3,5-trien-3-yl]-N,N'-dimethylpropanediamide |
|---|---|
| PubChem CID | 143768573 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | ethane;N'-[(3E)-hexa-1,3,5-trien-3-yl]-N,N'-dimethylpropanediamide |
| SMILES | C=C/C=C(\C=C)N(C)C(=O)CC(=O)NC.CC |
| InChI | InChI=1S/C11H16N2O2.C2H6/c1-5-7-9(6-2)13(4)11(15)8-10(14)12-3;1-2/h5-7H,1-2,8H2,3-4H3,(H,12,14);1-2H3/b9-7+; |
| InChIKey | JOARXYLCZXWJGM-BXTVWIJMSA-N |
| XLogP | 1.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|