C8H19N3O — CID 164800248
(2S)-2,4-diamino-N-tert-butylbutanamide (PubChem CID 164800248) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is (2S)-2,4-diamino-N-tert-butylbutanamide.
| Compound Name | (2S)-2,4-diamino-N-tert-butylbutanamide |
|---|---|
| PubChem CID | 164800248 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | (2S)-2,4-diamino-N-tert-butylbutanamide |
| SMILES | CC(C)(C)NC(=O)[C@@H](N)CCN |
| InChI | InChI=1S/C8H19N3O/c1-8(2,3)11-7(12)6(10)4-5-9/h6H,4-5,9-10H2,1-3H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | QVWZNJYNMYLZPN-LURJTMIESA-N |
| XLogP | -0.42 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |