C10H18O4S2 — CID 159328914
(2S)-3-[[(2S)-2-carboxypropyl]disulfanyl]-2,3-dimethylbutanoic acid (PubChem CID 159328914) has the molecular formula C10H18O4S2 and a molecular weight of 266.38 g/mol. Its IUPAC name is (2S)-3-[[(2S)-2-carboxypropyl]disulfanyl]-2,3-dimethylbutanoic acid.
| Compound Name | (2S)-3-[[(2S)-2-carboxypropyl]disulfanyl]-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 159328914 |
| Molecular Formula | C10H18O4S2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | (2S)-3-[[(2S)-2-carboxypropyl]disulfanyl]-2,3-dimethylbutanoic acid |
| SMILES | C[C@H](CSSC(C)(C)[C@@H](C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18O4S2/c1-6(8(11)12)5-15-16-10(3,4)7(2)9(13)14/h6-7H,5H2,1-4H3,(H,11,12)(H,13,14)/t6-,7+/m1/s1 |
| InChIKey | NSKHGWBKRJGWJL-RQJHMYQMSA-N |
| XLogP | 2.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|