C9H18N2O4S2 — CID 122677561
(2S)-2-amino-3-[[(3R)-3-amino-4-methoxy-2-methyl-4-oxobutan-2-yl]disulfanyl]propanoic acid (PubChem CID 122677561) has the molecular formula C9H18N2O4S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(3R)-3-amino-4-methoxy-2-methyl-4-oxobutan-2-yl]disulfanyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[[(3R)-3-amino-4-methoxy-2-methyl-4-oxobutan-2-yl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 122677561 |
| Molecular Formula | C9H18N2O4S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (2S)-2-amino-3-[[(3R)-3-amino-4-methoxy-2-methyl-4-oxobutan-2-yl]disulfanyl]propanoic acid |
| SMILES | COC(=O)[C@@H](N)C(C)(C)SSC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C9H18N2O4S2/c1-9(2,6(11)8(14)15-3)17-16-4-5(10)7(12)13/h5-6H,4,10-11H2,1-3H3,(H,12,13)/t5-,6-/m1/s1 |
| InChIKey | VUZPLDBGQXRQOI-PHDIDXHHSA-N |
| XLogP | 0.06 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|