C11H22N2O2S2 — CID 149056505
(3R)-4-[[(2R)-2-amino-3-oxobutyl]disulfanyl]-4-methyl-3-(methylamino)pentan-2-one (PubChem CID 149056505) has the molecular formula C11H22N2O2S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (3R)-4-[[(2R)-2-amino-3-oxobutyl]disulfanyl]-4-methyl-3-(methylamino)pentan-2-one.
| Compound Name | (3R)-4-[[(2R)-2-amino-3-oxobutyl]disulfanyl]-4-methyl-3-(methylamino)pentan-2-one |
|---|---|
| PubChem CID | 149056505 |
| Molecular Formula | C11H22N2O2S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (3R)-4-[[(2R)-2-amino-3-oxobutyl]disulfanyl]-4-methyl-3-(methylamino)pentan-2-one |
| SMILES | CN[C@H](C(C)=O)C(C)(C)SSC[C@H](N)C(C)=O |
| InChI | InChI=1S/C11H22N2O2S2/c1-7(14)9(12)6-16-17-11(3,4)10(13-5)8(2)15/h9-10,13H,6,12H2,1-5H3/t9-,10+/m0/s1 |
| InChIKey | QKYDJBZFJITEDN-VHSXEESVSA-N |
| XLogP | 1.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|