C9H18O2S2 — CID 122630060
(2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid (PubChem CID 122630060) has the molecular formula C9H18O2S2 and a molecular weight of 222.37 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid.
| Compound Name | (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid |
|---|---|
| PubChem CID | 122630060 |
| Molecular Formula | C9H18O2S2 |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid |
| SMILES | CCCSSC(C)(C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C9H18O2S2/c1-5-6-12-13-9(3,4)7(2)8(10)11/h7H,5-6H2,1-4H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | QQEJNYWEPZSZIR-ZETCQYMHSA-N |
| XLogP | 3.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|