(2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid

C9H18O2S2 — CID 122630060

IUPAC(2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid
SMILESCCCSSC(C)(C)[C@@H](C)C(=O)O
InChIInChI=1S/C9H18O2S2/c1-5-6-12-13-9(3,4)7(2)8(10)11/h7H,5-6H2,1-4H3,(H,10,11)/t7-/m0/s1
InChIKeyQQEJNYWEPZSZIR-ZETCQYMHSA-N
MW222.37 g/mol
LogP3.28
Rot. Bonds6

About (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid

(2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid (PubChem CID 122630060) has the molecular formula C9H18O2S2 and a molecular weight of 222.37 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid.

Molecular Properties

Compound Name(2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid
PubChem CID122630060
Molecular FormulaC9H18O2S2
Molecular Weight222.37 g/mol
Exact Mass222.07
IUPAC Name(2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid
SMILESCCCSSC(C)(C)[C@@H](C)C(=O)O
InChIInChI=1S/C9H18O2S2/c1-5-6-12-13-9(3,4)7(2)8(10)11/h7H,5-6H2,1-4H3,(H,10,11)/t7-/m0/s1
InChIKeyQQEJNYWEPZSZIR-ZETCQYMHSA-N
XLogP3.28
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.37
LogP ≤ 53.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}

Analyze (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid?
The IUPAC name of (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid (CID 122630060) is (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid.
What is the SMILES notation for (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid?
The canonical SMILES for (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid is CCCSSC(C)(C)[C@@H](C)C(=O)O.
What is the InChIKey of (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid?
The InChIKey is QQEJNYWEPZSZIR-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H18O2S2/c1-5-6-12-13-9(3,4)7(2)8(10)11/h7H,5-6H2,1-4H3,(H,10,11)/t7-/m0/s1.
What are the key properties of (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid?
(2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid has a molecular weight of 222.37 g/mol, XLogP of 3.28, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-dimethyl-3-(propyldisulfanyl)butanoic acid is sourced from PubChem (CID 122630060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).