C12H24O2S2 — CID 19706190
3-ethylsulfanyl-2-(2-ethylsulfanylpropan-2-yl)-3-methylbutanoic acid (PubChem CID 19706190) has the molecular formula C12H24O2S2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 3-ethylsulfanyl-2-(2-ethylsulfanylpropan-2-yl)-3-methylbutanoic acid.
| Compound Name | 3-ethylsulfanyl-2-(2-ethylsulfanylpropan-2-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19706190 |
| Molecular Formula | C12H24O2S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3-ethylsulfanyl-2-(2-ethylsulfanylpropan-2-yl)-3-methylbutanoic acid |
| SMILES | CCSC(C)(C)C(C(=O)O)C(C)(C)SCC |
| InChI | InChI=1S/C12H24O2S2/c1-7-15-11(3,4)9(10(13)14)12(5,6)16-8-2/h9H,7-8H2,1-6H3,(H,13,14) |
| InChIKey | NRWIOHWNGBZNHG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |