C10H20O4S2 — CID 106721869
3-(2-tert-butylsulfonylethylsulfanyl)-2-methylpropanoic acid (PubChem CID 106721869) has the molecular formula C10H20O4S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3-(2-tert-butylsulfonylethylsulfanyl)-2-methylpropanoic acid.
| Compound Name | 3-(2-tert-butylsulfonylethylsulfanyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 106721869 |
| Molecular Formula | C10H20O4S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-(2-tert-butylsulfonylethylsulfanyl)-2-methylpropanoic acid |
| SMILES | CC(CSCCS(=O)(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H20O4S2/c1-8(9(11)12)7-15-5-6-16(13,14)10(2,3)4/h8H,5-7H2,1-4H3,(H,11,12) |
| InChIKey | NGYOUYIURWIVEJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|