C10H20O4S2 — CID 106721890
2-(2-tert-butylsulfonylethylsulfanyl)-2-methylpropanoic acid (PubChem CID 106721890) has the molecular formula C10H20O4S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-(2-tert-butylsulfonylethylsulfanyl)-2-methylpropanoic acid.
| Compound Name | 2-(2-tert-butylsulfonylethylsulfanyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 106721890 |
| Molecular Formula | C10H20O4S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-(2-tert-butylsulfonylethylsulfanyl)-2-methylpropanoic acid |
| SMILES | CC(C)(SCCS(=O)(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H20O4S2/c1-9(2,3)16(13,14)7-6-15-10(4,5)8(11)12/h6-7H2,1-5H3,(H,11,12) |
| InChIKey | JFEAYSRTVBMTJD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |