C7H15NO4S — CID 87536259
2-tert-butylsulfonylethylcarbamic acid (PubChem CID 87536259) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-tert-butylsulfonylethylcarbamic acid.
| Compound Name | 2-tert-butylsulfonylethylcarbamic acid |
|---|---|
| PubChem CID | 87536259 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-tert-butylsulfonylethylcarbamic acid |
| SMILES | CC(C)(C)S(=O)(=O)CCNC(=O)O |
| InChI | InChI=1S/C7H15NO4S/c1-7(2,3)13(11,12)5-4-8-6(9)10/h8H,4-5H2,1-3H3,(H,9,10) |
| InChIKey | GELORPDCOWHEGN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |