C9H20N2O3S — CID 106723192
2-(2-tert-butylsulfonylethylamino)-N-methylacetamide (PubChem CID 106723192) has the molecular formula C9H20N2O3S and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-(2-tert-butylsulfonylethylamino)-N-methylacetamide.
| Compound Name | 2-(2-tert-butylsulfonylethylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 106723192 |
| Molecular Formula | C9H20N2O3S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-(2-tert-butylsulfonylethylamino)-N-methylacetamide |
| SMILES | CNC(=O)CNCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C9H20N2O3S/c1-9(2,3)15(13,14)6-5-11-7-8(12)10-4/h11H,5-7H2,1-4H3,(H,10,12) |
| InChIKey | QXHFMGOSBQUYFX-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|