C12H28N2O2S — CID 106723490
1-N-(2-tert-butylsulfonylethyl)-2-N,2-N,2-trimethylpropane-1,2-diamine (PubChem CID 106723490) has the molecular formula C12H28N2O2S and a molecular weight of 264.43 g/mol. Its IUPAC name is 1-N-(2-tert-butylsulfonylethyl)-2-N,2-N,2-trimethylpropane-1,2-diamine.
| Compound Name | 1-N-(2-tert-butylsulfonylethyl)-2-N,2-N,2-trimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 106723490 |
| Molecular Formula | C12H28N2O2S |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 1-N-(2-tert-butylsulfonylethyl)-2-N,2-N,2-trimethylpropane-1,2-diamine |
| SMILES | CN(C)C(C)(C)CNCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C12H28N2O2S/c1-11(2,3)17(15,16)9-8-13-10-12(4,5)14(6)7/h13H,8-10H2,1-7H3 |
| InChIKey | FGYFVHSLVMLKIA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|