C13H27NO4S2 — CID 138577819
N-(2-tert-butylsulfonylethyl)-2-cyclopropylsulfonyl-2-methylpropan-1-amine (PubChem CID 138577819) has the molecular formula C13H27NO4S2 and a molecular weight of 325.50 g/mol. Its IUPAC name is N-(2-tert-butylsulfonylethyl)-2-cyclopropylsulfonyl-2-methylpropan-1-amine.
| Compound Name | N-(2-tert-butylsulfonylethyl)-2-cyclopropylsulfonyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 138577819 |
| Molecular Formula | C13H27NO4S2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-(2-tert-butylsulfonylethyl)-2-cyclopropylsulfonyl-2-methylpropan-1-amine |
| SMILES | CC(C)(C)S(=O)(=O)CCNCC(C)(C)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C13H27NO4S2/c1-12(2,3)19(15,16)9-8-14-10-13(4,5)20(17,18)11-6-7-11/h11,14H,6-10H2,1-5H3 |
| InChIKey | DDXRNEMLYFUQQB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|