C8H20N2O2S — CID 106724235
2-(2-tert-butylsulfonylethyl)-1,1-dimethylhydrazine (PubChem CID 106724235) has the molecular formula C8H20N2O2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-(2-tert-butylsulfonylethyl)-1,1-dimethylhydrazine.
| Compound Name | 2-(2-tert-butylsulfonylethyl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 106724235 |
| Molecular Formula | C8H20N2O2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(2-tert-butylsulfonylethyl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C8H20N2O2S/c1-8(2,3)13(11,12)7-6-9-10(4)5/h9H,6-7H2,1-5H3 |
| InChIKey | PMGLVTWINURKBP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|