C11H25NO4S — CID 107865483
2-(2-tert-butylsulfonylethylamino)-2-ethylpropane-1,3-diol (PubChem CID 107865483) has the molecular formula C11H25NO4S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-(2-tert-butylsulfonylethylamino)-2-ethylpropane-1,3-diol.
| Compound Name | 2-(2-tert-butylsulfonylethylamino)-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 107865483 |
| Molecular Formula | C11H25NO4S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-(2-tert-butylsulfonylethylamino)-2-ethylpropane-1,3-diol |
| SMILES | CCC(CO)(CO)NCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C11H25NO4S/c1-5-11(8-13,9-14)12-6-7-17(15,16)10(2,3)4/h12-14H,5-9H2,1-4H3 |
| InChIKey | JROISUSEEHAFPJ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |