C13H27N3O3S2 — CID 175700271
(2S)-6-amino-2-[[(2R)-2-amino-3-(tert-butyldisulfanyl)propanoyl]amino]hexanoic acid (PubChem CID 175700271) has the molecular formula C13H27N3O3S2 and a molecular weight of 337.51 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-2-amino-3-(tert-butyldisulfanyl)propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2R)-2-amino-3-(tert-butyldisulfanyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175700271 |
| Molecular Formula | C13H27N3O3S2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-2-amino-3-(tert-butyldisulfanyl)propanoyl]amino]hexanoic acid |
| SMILES | CC(C)(C)SSC[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C13H27N3O3S2/c1-13(2,3)21-20-8-9(15)11(17)16-10(12(18)19)6-4-5-7-14/h9-10H,4-8,14-15H2,1-3H3,(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | DIWOXNWZTRBRLO-UWVGGRQHSA-N |
| XLogP | 1.19 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|