C19H40N8O3S2 — CID 101197561
(2S)-2,6-diamino-N-[(2R)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(tert-butyldisulfanyl)-1-oxopropan-2-yl]hexanamide (PubChem CID 101197561) has the molecular formula C19H40N8O3S2 and a molecular weight of 492.72 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2R)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(tert-butyldisulfanyl)-1-oxopropan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2R)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(tert-butyldisulfanyl)-1-oxopropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 101197561 |
| Molecular Formula | C19H40N8O3S2 |
| Molecular Weight | 492.72 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2R)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(tert-butyldisulfanyl)-1-oxopropan-2-yl]hexanamide |
| SMILES | CC(C)(C)SSC[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C19H40N8O3S2/c1-19(2,3)32-31-11-14(27-16(29)12(21)7-4-5-9-20)17(30)26-13(15(22)28)8-6-10-25-18(23)24/h12-14H,4-11,20-21H2,1-3H3,(H2,22,28)(H,26,30)(H,27,29)(H4,23,24,25)/t12-,13-,14-/m0/s1 |
| InChIKey | CDQMINSOKJCXKY-IHRRRGAJSA-N |
| XLogP | -0.87 |
| TPSA | 217.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.72 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|