C18H33N3O5S2 — CID 88545487
4-[[3-(tert-butyldisulfanyl)-2-(2-methylpropoxycarbonylamino)propanoyl]amino]piperidine-1-carboxylic acid (PubChem CID 88545487) has the molecular formula C18H33N3O5S2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 4-[[3-(tert-butyldisulfanyl)-2-(2-methylpropoxycarbonylamino)propanoyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[[3-(tert-butyldisulfanyl)-2-(2-methylpropoxycarbonylamino)propanoyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 88545487 |
| Molecular Formula | C18H33N3O5S2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 4-[[3-(tert-butyldisulfanyl)-2-(2-methylpropoxycarbonylamino)propanoyl]amino]piperidine-1-carboxylic acid |
| SMILES | CC(C)COC(=O)NC(CSSC(C)(C)C)C(=O)NC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C18H33N3O5S2/c1-12(2)10-26-16(23)20-14(11-27-28-18(3,4)5)15(22)19-13-6-8-21(9-7-13)17(24)25/h12-14H,6-11H2,1-5H3,(H,19,22)(H,20,23)(H,24,25) |
| InChIKey | NLCYUOHWDFDOPS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|