C15H25N3O3S — CID 123457644
2-methylpropyl N-[1-[(1-methylpiperidin-4-yl)amino]-1-oxo-4-sulfanylidenebut-3-en-2-yl]carbamate (PubChem CID 123457644) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-methylpropyl N-[1-[(1-methylpiperidin-4-yl)amino]-1-oxo-4-sulfanylidenebut-3-en-2-yl]carbamate.
| Compound Name | 2-methylpropyl N-[1-[(1-methylpiperidin-4-yl)amino]-1-oxo-4-sulfanylidenebut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 123457644 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-methylpropyl N-[1-[(1-methylpiperidin-4-yl)amino]-1-oxo-4-sulfanylidenebut-3-en-2-yl]carbamate |
| SMILES | CC(C)COC(=O)NC(C=C=S)C(=O)NC1CCN(C)CC1 |
| InChI | InChI=1S/C15H25N3O3S/c1-11(2)10-21-15(20)17-13(6-9-22)14(19)16-12-4-7-18(3)8-5-12/h6,11-13H,4-5,7-8,10H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | VLMUEUQDUUFQDH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|