C20H12F2N2O5 — CID 67342960
4-(2,4-difluorophenyl)-2-[(4-nitrobenzoyl)amino]benzoic acid (PubChem CID 67342960) has the molecular formula C20H12F2N2O5 and a molecular weight of 398.32 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-2-[(4-nitrobenzoyl)amino]benzoic acid.
| Compound Name | 4-(2,4-difluorophenyl)-2-[(4-nitrobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 67342960 |
| Molecular Formula | C20H12F2N2O5 |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 4-(2,4-difluorophenyl)-2-[(4-nitrobenzoyl)amino]benzoic acid |
| SMILES | O=C(Nc1cc(-c2ccc(F)cc2F)ccc1C(=O)O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H12F2N2O5/c21-13-4-8-15(17(22)10-13)12-3-7-16(20(26)27)18(9-12)23-19(25)11-1-5-14(6-2-11)24(28)29/h1-10H,(H,23,25)(H,26,27) |
| InChIKey | IKTOAYYHRVRHIN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|