C17H18N2O5 — CID 86925249
N-(4-ethyl-3-nitrophenyl)-2,5-dimethoxybenzamide (PubChem CID 86925249) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-(4-ethyl-3-nitrophenyl)-2,5-dimethoxybenzamide.
| Compound Name | N-(4-ethyl-3-nitrophenyl)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 86925249 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-(4-ethyl-3-nitrophenyl)-2,5-dimethoxybenzamide |
| SMILES | CCc1ccc(NC(=O)c2cc(OC)ccc2OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O5/c1-4-11-5-6-12(9-15(11)19(21)22)18-17(20)14-10-13(23-2)7-8-16(14)24-3/h5-10H,4H2,1-3H3,(H,18,20) |
| InChIKey | WIOJCNSFJIONPR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|