C16H16N2O4 — CID 953258
N-(4-methoxy-3-nitrophenyl)-2,4-dimethylbenzamide (PubChem CID 953258) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is N-(4-methoxy-3-nitrophenyl)-2,4-dimethylbenzamide.
| Compound Name | N-(4-methoxy-3-nitrophenyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 953258 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(4-methoxy-3-nitrophenyl)-2,4-dimethylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(C)cc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N2O4/c1-10-4-6-13(11(2)8-10)16(19)17-12-5-7-15(22-3)14(9-12)18(20)21/h4-9H,1-3H3,(H,17,19) |
| InChIKey | NPIHSOKHDQUBBH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|