C16H15N3O8 — CID 5304694
2,4-dimethoxy-N-(4-methoxy-3,5-dinitrophenyl)benzamide (PubChem CID 5304694) has the molecular formula C16H15N3O8 and a molecular weight of 377.31 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(4-methoxy-3,5-dinitrophenyl)benzamide.
| Compound Name | 2,4-dimethoxy-N-(4-methoxy-3,5-dinitrophenyl)benzamide |
|---|---|
| PubChem CID | 5304694 |
| Molecular Formula | C16H15N3O8 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2,4-dimethoxy-N-(4-methoxy-3,5-dinitrophenyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc([N+](=O)[O-])c(OC)c([N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C16H15N3O8/c1-25-10-4-5-11(14(8-10)26-2)16(20)17-9-6-12(18(21)22)15(27-3)13(7-9)19(23)24/h4-8H,1-3H3,(H,17,20) |
| InChIKey | ICKPGJREGDSDOJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 143.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|