C18H16N2O8 — CID 47845357
dimethyl 5-[(5-methoxy-2-nitrobenzoyl)amino]benzene-1,3-dicarboxylate (PubChem CID 47845357) has the molecular formula C18H16N2O8 and a molecular weight of 388.33 g/mol. Its IUPAC name is dimethyl 5-[(5-methoxy-2-nitrobenzoyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(5-methoxy-2-nitrobenzoyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 47845357 |
| Molecular Formula | C18H16N2O8 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | dimethyl 5-[(5-methoxy-2-nitrobenzoyl)amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2cc(OC)ccc2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H16N2O8/c1-26-13-4-5-15(20(24)25)14(9-13)16(21)19-12-7-10(17(22)27-2)6-11(8-12)18(23)28-3/h4-9H,1-3H3,(H,19,21) |
| InChIKey | IZGKEEVQPVPHCN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|