C16H10F4N2O6 — CID 59848994
5-methoxy-2-nitro-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)benzamide (PubChem CID 59848994) has the molecular formula C16H10F4N2O6 and a molecular weight of 402.26 g/mol. Its IUPAC name is 5-methoxy-2-nitro-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)benzamide.
| Compound Name | 5-methoxy-2-nitro-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)benzamide |
|---|---|
| PubChem CID | 59848994 |
| Molecular Formula | C16H10F4N2O6 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 5-methoxy-2-nitro-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)benzamide |
| SMILES | COc1ccc([N+](=O)[O-])c(C(=O)Nc2ccc3c(c2)OC(F)(F)C(F)(F)O3)c1 |
| InChI | InChI=1S/C16H10F4N2O6/c1-26-9-3-4-11(22(24)25)10(7-9)14(23)21-8-2-5-12-13(6-8)28-16(19,20)15(17,18)27-12/h2-7H,1H3,(H,21,23) |
| InChIKey | NAGUXXPNHBKQDL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|