C17H14F3N3O5 — CID 55752418
N-(4-acetamidophenyl)-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 55752418) has the molecular formula C17H14F3N3O5 and a molecular weight of 397.31 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(4-acetamidophenyl)-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 55752418 |
| Molecular Formula | C17H14F3N3O5 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-(4-acetamidophenyl)-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cc(OCC(F)(F)F)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14F3N3O5/c1-10(24)21-11-2-4-12(5-3-11)22-16(25)14-8-13(28-9-17(18,19)20)6-7-15(14)23(26)27/h2-8H,9H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | JJWAXTTZLAXYKP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|