C19H16F3N3O5 — CID 55741479
N-[3-(cyclopropanecarbonylamino)phenyl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 55741479) has the molecular formula C19H16F3N3O5 and a molecular weight of 423.35 g/mol. Its IUPAC name is N-[3-(cyclopropanecarbonylamino)phenyl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-[3-(cyclopropanecarbonylamino)phenyl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 55741479 |
| Molecular Formula | C19H16F3N3O5 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[3-(cyclopropanecarbonylamino)phenyl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(Nc1cccc(NC(=O)C2CC2)c1)c1cc(OCC(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16F3N3O5/c20-19(21,22)10-30-14-6-7-16(25(28)29)15(9-14)18(27)24-13-3-1-2-12(8-13)23-17(26)11-4-5-11/h1-3,6-9,11H,4-5,10H2,(H,23,26)(H,24,27) |
| InChIKey | NACGSYVFWNMTDF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|