C15H19ClF3N3O4 — CID 119561001
[4-(methylamino)piperidin-1-yl]-[2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]methanone;hydrochloride (PubChem CID 119561001) has the molecular formula C15H19ClF3N3O4 and a molecular weight of 397.78 g/mol. Its IUPAC name is [4-(methylamino)piperidin-1-yl]-[2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]methanone;hydrochloride.
| Compound Name | [4-(methylamino)piperidin-1-yl]-[2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119561001 |
| Molecular Formula | C15H19ClF3N3O4 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [4-(methylamino)piperidin-1-yl]-[2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]methanone;hydrochloride |
| SMILES | CNC1CCN(C(=O)c2cc(OCC(F)(F)F)ccc2[N+](=O)[O-])CC1.Cl |
| InChI | InChI=1S/C15H18F3N3O4.ClH/c1-19-10-4-6-20(7-5-10)14(22)12-8-11(25-9-15(16,17)18)2-3-13(12)21(23)24;/h2-3,8,10,19H,4-7,9H2,1H3;1H |
| InChIKey | VUNXHVQTWFLDNV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|