C13H15ClF3N3O4 — CID 119401203
[2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]-piperazin-1-ylmethanone;hydrochloride (PubChem CID 119401203) has the molecular formula C13H15ClF3N3O4 and a molecular weight of 369.73 g/mol. Its IUPAC name is [2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | [2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119401203 |
| Molecular Formula | C13H15ClF3N3O4 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | [2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1cc(OCC(F)(F)F)ccc1[N+](=O)[O-])N1CCNCC1 |
| InChI | InChI=1S/C13H14F3N3O4.ClH/c14-13(15,16)8-23-9-1-2-11(19(21)22)10(7-9)12(20)18-5-3-17-4-6-18;/h1-2,7,17H,3-6,8H2;1H |
| InChIKey | QPGFPGNOVNANKB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|