C18H22F3N3O5 — CID 55740151
N-[1-(2-methylpropanoyl)piperidin-4-yl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 55740151) has the molecular formula C18H22F3N3O5 and a molecular weight of 417.38 g/mol. Its IUPAC name is N-[1-(2-methylpropanoyl)piperidin-4-yl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-[1-(2-methylpropanoyl)piperidin-4-yl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 55740151 |
| Molecular Formula | C18H22F3N3O5 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[1-(2-methylpropanoyl)piperidin-4-yl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CC(C)C(=O)N1CCC(NC(=O)c2cc(OCC(F)(F)F)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H22F3N3O5/c1-11(2)17(26)23-7-5-12(6-8-23)22-16(25)14-9-13(29-10-18(19,20)21)3-4-15(14)24(27)28/h3-4,9,11-12H,5-8,10H2,1-2H3,(H,22,25) |
| InChIKey | WOJQEJVFQYYTME-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|