C20H22F3N3O4 — CID 55793927
N-(2-anilino-3-methylbutyl)-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 55793927) has the molecular formula C20H22F3N3O4 and a molecular weight of 425.41 g/mol. Its IUPAC name is N-(2-anilino-3-methylbutyl)-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(2-anilino-3-methylbutyl)-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 55793927 |
| Molecular Formula | C20H22F3N3O4 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-(2-anilino-3-methylbutyl)-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CC(C)C(CNC(=O)c1cc(OCC(F)(F)F)ccc1[N+](=O)[O-])Nc1ccccc1 |
| InChI | InChI=1S/C20H22F3N3O4/c1-13(2)17(25-14-6-4-3-5-7-14)11-24-19(27)16-10-15(30-12-20(21,22)23)8-9-18(16)26(28)29/h3-10,13,17,25H,11-12H2,1-2H3,(H,24,27) |
| InChIKey | GPYKNRWNKCWWDU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|