C17H11F3N4O4S — CID 55756714
2-nitro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-5-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 55756714) has the molecular formula C17H11F3N4O4S and a molecular weight of 424.36 g/mol. Its IUPAC name is 2-nitro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-5-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 2-nitro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-5-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 55756714 |
| Molecular Formula | C17H11F3N4O4S |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 2-nitro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-5-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2)s1)c1cc(OCC(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11F3N4O4S/c18-17(19,20)9-28-11-6-7-13(24(26)27)12(8-11)14(25)21-16-23-22-15(29-16)10-4-2-1-3-5-10/h1-8H,9H2,(H,21,23,25) |
| InChIKey | OLBGNTLLSFVZSZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|