C21H12N6O8S — CID 118710356
N-[5-[4-(2,4-dinitrophenoxy)phenyl]-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide (PubChem CID 118710356) has the molecular formula C21H12N6O8S and a molecular weight of 508.43 g/mol. Its IUPAC name is N-[5-[4-(2,4-dinitrophenoxy)phenyl]-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide.
| Compound Name | N-[5-[4-(2,4-dinitrophenoxy)phenyl]-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 118710356 |
| Molecular Formula | C21H12N6O8S |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | N-[5-[4-(2,4-dinitrophenoxy)phenyl]-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide |
| SMILES | O=C(Nc1nnc(-c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)s1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H12N6O8S/c28-19(15-3-1-2-4-16(15)26(31)32)22-21-24-23-20(36-21)12-5-8-14(9-6-12)35-18-10-7-13(25(29)30)11-17(18)27(33)34/h1-11H,(H,22,24,28) |
| InChIKey | BHVMHOUHHAONSX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 193.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|