C25H19N5O5S — CID 45018806
N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide (PubChem CID 45018806) has the molecular formula C25H19N5O5S and a molecular weight of 501.52 g/mol. Its IUPAC name is N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 45018806 |
| Molecular Formula | C25H19N5O5S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide |
| SMILES | COc1ccc(-c2nnc(NC(=O)c3ccccc3NC(=O)/C=C/c3cccc([N+](=O)[O-])c3)s2)cc1 |
| InChI | InChI=1S/C25H19N5O5S/c1-35-19-12-10-17(11-13-19)24-28-29-25(36-24)27-23(32)20-7-2-3-8-21(20)26-22(31)14-9-16-5-4-6-18(15-16)30(33)34/h2-15H,1H3,(H,26,31)(H,27,29,32)/b14-9+ |
| InChIKey | ZBYIFVSSQQTPHF-NTEUORMPSA-N |
| XLogP | 5.03 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|