C22H15N5O7S — CID 118710349
N-[5-[4-(2,4-dinitrophenoxy)phenyl]-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide (PubChem CID 118710349) has the molecular formula C22H15N5O7S and a molecular weight of 493.46 g/mol. Its IUPAC name is N-[5-[4-(2,4-dinitrophenoxy)phenyl]-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide.
| Compound Name | N-[5-[4-(2,4-dinitrophenoxy)phenyl]-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 118710349 |
| Molecular Formula | C22H15N5O7S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | N-[5-[4-(2,4-dinitrophenoxy)phenyl]-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1nnc(-c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C22H15N5O7S/c1-33-18-5-3-2-4-16(18)20(28)23-22-25-24-21(35-22)13-6-9-15(10-7-13)34-19-11-8-14(26(29)30)12-17(19)27(31)32/h2-12H,1H3,(H,23,25,28) |
| InChIKey | IKMGUFBLMPRXEX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 159.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|