C11H8F3N5O4 — CID 60506875
2-nitro-N-(1H-1,2,4-triazol-5-yl)-5-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 60506875) has the molecular formula C11H8F3N5O4 and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-nitro-N-(1H-1,2,4-triazol-5-yl)-5-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 2-nitro-N-(1H-1,2,4-triazol-5-yl)-5-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 60506875 |
| Molecular Formula | C11H8F3N5O4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 2-nitro-N-(1H-1,2,4-triazol-5-yl)-5-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1cc(OCC(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8F3N5O4/c12-11(13,14)4-23-6-1-2-8(19(21)22)7(3-6)9(20)17-10-15-5-16-18-10/h1-3,5H,4H2,(H2,15,16,17,18,20) |
| InChIKey | DKBUZSFVSOQJHB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|