C19H15F3N2O5 — CID 55739206
N-[1-(1-benzofuran-2-yl)ethyl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 55739206) has the molecular formula C19H15F3N2O5 and a molecular weight of 408.33 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 55739206 |
| Molecular Formula | C19H15F3N2O5 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-2-nitro-5-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CC(NC(=O)c1cc(OCC(F)(F)F)ccc1[N+](=O)[O-])c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H15F3N2O5/c1-11(17-8-12-4-2-3-5-16(12)29-17)23-18(25)14-9-13(28-10-19(20,21)22)6-7-15(14)24(26)27/h2-9,11H,10H2,1H3,(H,23,25) |
| InChIKey | DTFSVKRCVSSVLC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|