C18H16N2O4 — CID 17493309
N-[1-(1-benzofuran-2-yl)ethyl]-3-methyl-4-nitrobenzamide (PubChem CID 17493309) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 17493309 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NC(C)c2cc3ccccc3o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N2O4/c1-11-9-14(7-8-15(11)20(22)23)18(21)19-12(2)17-10-13-5-3-4-6-16(13)24-17/h3-10,12H,1-2H3,(H,19,21) |
| InChIKey | HQDGTXOLECJKBE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|