C27H21FN2O4 — CID 154628608
methyl 4-[[[2-(4-fluorophenoxy)-5-pyridin-2-ylbenzoyl]amino]methyl]benzoate (PubChem CID 154628608) has the molecular formula C27H21FN2O4 and a molecular weight of 456.47 g/mol. Its IUPAC name is methyl 4-[[[2-(4-fluorophenoxy)-5-pyridin-2-ylbenzoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-(4-fluorophenoxy)-5-pyridin-2-ylbenzoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 154628608 |
| Molecular Formula | C27H21FN2O4 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | methyl 4-[[[2-(4-fluorophenoxy)-5-pyridin-2-ylbenzoyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2cc(-c3ccccn3)ccc2Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H21FN2O4/c1-33-27(32)19-7-5-18(6-8-19)17-30-26(31)23-16-20(24-4-2-3-15-29-24)9-14-25(23)34-22-12-10-21(28)11-13-22/h2-16H,17H2,1H3,(H,30,31) |
| InChIKey | IYEBINAAUWUJDO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |