C28H21ClFNO4 — CID 154628595
methyl 4-[[[5-(3-chlorophenyl)-2-(4-fluorophenoxy)benzoyl]amino]methyl]benzoate (PubChem CID 154628595) has the molecular formula C28H21ClFNO4 and a molecular weight of 489.93 g/mol. Its IUPAC name is methyl 4-[[[5-(3-chlorophenyl)-2-(4-fluorophenoxy)benzoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[5-(3-chlorophenyl)-2-(4-fluorophenoxy)benzoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 154628595 |
| Molecular Formula | C28H21ClFNO4 |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | methyl 4-[[[5-(3-chlorophenyl)-2-(4-fluorophenoxy)benzoyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2cc(-c3cccc(Cl)c3)ccc2Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H21ClFNO4/c1-34-28(33)19-7-5-18(6-8-19)17-31-27(32)25-16-21(20-3-2-4-22(29)15-20)9-14-26(25)35-24-12-10-23(30)11-13-24/h2-16H,17H2,1H3,(H,31,32) |
| InChIKey | XLDNECWOZKIZNQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |