About (2,6-difluorophenyl) thiohypoiodite
(2,6-difluorophenyl) thiohypoiodite (PubChem CID 146181225) has the molecular formula C6H3F2IS
and a molecular weight of 272.06 g/mol. Its IUPAC name is (2,6-difluorophenyl) thiohypoiodite.
Molecular Properties
| Compound Name | (2,6-difluorophenyl) thiohypoiodite |
| PubChem CID | 146181225 |
| Molecular Formula | C6H3F2IS |
| Molecular Weight | 272.06 g/mol |
| Exact Mass | 271.90 |
| IUPAC Name | (2,6-difluorophenyl) thiohypoiodite |
| SMILES | Fc1cccc(F)c1SI |
| InChI | InChI=1S/C6H3F2IS/c7-4-2-1-3-5(8)6(4)10-9/h1-3H |
| InChIKey | QUOWJIOKBPOZRI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.06 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2,6-difluorophenyl) thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-difluorophenyl) thiohypoiodite?
The IUPAC name of (2,6-difluorophenyl) thiohypoiodite (CID 146181225) is (2,6-difluorophenyl) thiohypoiodite.
What is the SMILES notation for (2,6-difluorophenyl) thiohypoiodite?
The canonical SMILES for (2,6-difluorophenyl) thiohypoiodite is Fc1cccc(F)c1SI.
What is the InChIKey of (2,6-difluorophenyl) thiohypoiodite?
The InChIKey is QUOWJIOKBPOZRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F2IS/c7-4-2-1-3-5(8)6(4)10-9/h1-3H.
What are the key properties of (2,6-difluorophenyl) thiohypoiodite?
(2,6-difluorophenyl) thiohypoiodite has a molecular weight of 272.06 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorophenyl) thiohypoiodite is sourced from PubChem (CID 146181225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).