C19H23ClFNO2S — CID 2811921
5-tert-butyl-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-methylfuran-3-carboxamide (PubChem CID 2811921) has the molecular formula C19H23ClFNO2S and a molecular weight of 383.92 g/mol. Its IUPAC name is 5-tert-butyl-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-methylfuran-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 2811921 |
| Molecular Formula | C19H23ClFNO2S |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 5-tert-butyl-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1oc(C(C)(C)C)cc1C(=O)NCCSCc1c(F)cccc1Cl |
| InChI | InChI=1S/C19H23ClFNO2S/c1-12-13(10-17(24-12)19(2,3)4)18(23)22-8-9-25-11-14-15(20)6-5-7-16(14)21/h5-7,10H,8-9,11H2,1-4H3,(H,22,23) |
| InChIKey | VIHLHTKPBSTOIK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|