C20H30ClFO3S2 — CID 58145431
9-tert-butylsulfonyl-1-[(2-chloro-6-fluorophenyl)methylsulfanyl]nonan-4-one (PubChem CID 58145431) has the molecular formula C20H30ClFO3S2 and a molecular weight of 437.04 g/mol. Its IUPAC name is 9-tert-butylsulfonyl-1-[(2-chloro-6-fluorophenyl)methylsulfanyl]nonan-4-one.
| Compound Name | 9-tert-butylsulfonyl-1-[(2-chloro-6-fluorophenyl)methylsulfanyl]nonan-4-one |
|---|---|
| PubChem CID | 58145431 |
| Molecular Formula | C20H30ClFO3S2 |
| Molecular Weight | 437.04 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 9-tert-butylsulfonyl-1-[(2-chloro-6-fluorophenyl)methylsulfanyl]nonan-4-one |
| SMILES | CC(C)(C)S(=O)(=O)CCCCCC(=O)CCCSCc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H30ClFO3S2/c1-20(2,3)27(24,25)14-6-4-5-9-16(23)10-8-13-26-15-17-18(21)11-7-12-19(17)22/h7,11-12H,4-6,8-10,13-15H2,1-3H3 |
| InChIKey | KKTBROXQJHSUJS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.04 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|