C17H28ClFN2O2S2 — CID 70939394
N-[5-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]pentyl]propane-2-sulfonamide (PubChem CID 70939394) has the molecular formula C17H28ClFN2O2S2 and a molecular weight of 411.01 g/mol. Its IUPAC name is N-[5-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70939394 |
| Molecular Formula | C17H28ClFN2O2S2 |
| Molecular Weight | 411.01 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[5-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]pentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCCCNCCSCc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H28ClFN2O2S2/c1-14(2)25(22,23)21-10-5-3-4-9-20-11-12-24-13-15-16(18)7-6-8-17(15)19/h6-8,14,20-21H,3-5,9-13H2,1-2H3 |
| InChIKey | YQBUTTIZZYXDBE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.01 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|