C13H12BrClFNO2S3 — CID 126180205
5-bromo-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]thiophene-2-sulfonamide (PubChem CID 126180205) has the molecular formula C13H12BrClFNO2S3 and a molecular weight of 444.80 g/mol. Its IUPAC name is 5-bromo-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 126180205 |
| Molecular Formula | C13H12BrClFNO2S3 |
| Molecular Weight | 444.80 g/mol |
| Exact Mass | 442.89 |
| IUPAC Name | 5-bromo-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCSCc1c(F)cccc1Cl)c1ccc(Br)s1 |
| InChI | InChI=1S/C13H12BrClFNO2S3/c14-12-4-5-13(21-12)22(18,19)17-6-7-20-8-9-10(15)2-1-3-11(9)16/h1-5,17H,6-8H2 |
| InChIKey | POPHEZZYEZNVSZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|