C18H15Cl2FN4O3S3 — CID 100678796
2-chloro-N-[5-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100678796) has the molecular formula C18H15Cl2FN4O3S3 and a molecular weight of 521.45 g/mol. Its IUPAC name is 2-chloro-N-[5-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100678796 |
| Molecular Formula | C18H15Cl2FN4O3S3 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 519.97 |
| IUPAC Name | 2-chloro-N-[5-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)NCCSCc2c(F)cccc2Cl)s1)c1ccccc1Cl |
| InChI | InChI=1S/C18H15Cl2FN4O3S3/c19-13-5-2-1-4-11(13)16(26)23-17-24-25-18(30-17)31(27,28)22-8-9-29-10-12-14(20)6-3-7-15(12)21/h1-7,22H,8-10H2,(H,23,24,26) |
| InChIKey | ZPDXMEALYVNBKG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|